C16H35NO — CID 172516818
N,2,2-trimethyl-N-[3-(5-methylhexoxy)propyl]propan-1-amine (PubChem CID 172516818) has the molecular formula C16H35NO and a molecular weight of 257.46 g/mol. Its IUPAC name is N,2,2-trimethyl-N-[3-(5-methylhexoxy)propyl]propan-1-amine.
| Compound Name | N,2,2-trimethyl-N-[3-(5-methylhexoxy)propyl]propan-1-amine |
|---|---|
| PubChem CID | 172516818 |
| Molecular Formula | C16H35NO |
| Molecular Weight | 257.46 g/mol |
| Exact Mass | 257.27 |
| IUPAC Name | N,2,2-trimethyl-N-[3-(5-methylhexoxy)propyl]propan-1-amine |
| SMILES | CC(C)CCCCOCCCN(C)CC(C)(C)C |
| InChI | InChI=1S/C16H35NO/c1-15(2)10-7-8-12-18-13-9-11-17(6)14-16(3,4)5/h15H,7-14H2,1-6H3 |
| InChIKey | QPCOQGUYFRCUFN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|