C17H37NO4 — CID 54380634
1-[hydroxy-[3-(10-methylundecoxy)propyl]amino]ethane-1,1-diol (PubChem CID 54380634) has the molecular formula C17H37NO4 and a molecular weight of 319.49 g/mol. Its IUPAC name is 1-[hydroxy-[3-(10-methylundecoxy)propyl]amino]ethane-1,1-diol.
| Compound Name | 1-[hydroxy-[3-(10-methylundecoxy)propyl]amino]ethane-1,1-diol |
|---|---|
| PubChem CID | 54380634 |
| Molecular Formula | C17H37NO4 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.27 |
| IUPAC Name | 1-[hydroxy-[3-(10-methylundecoxy)propyl]amino]ethane-1,1-diol |
| SMILES | CC(C)CCCCCCCCCOCCCN(O)C(C)(O)O |
| InChI | InChI=1S/C17H37NO4/c1-16(2)12-9-7-5-4-6-8-10-14-22-15-11-13-18(21)17(3,19)20/h16,19-21H,4-15H2,1-3H3 |
| InChIKey | UZQKMRGOFKJIFD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|