About CID 172517050
CID 172517050 (PubChem CID 172517050) has the molecular formula C11H9BNO2
and a molecular weight of 198.01 g/mol.
Molecular Properties
| Compound Name | CID 172517050 |
| PubChem CID | 172517050 |
| Molecular Formula | C11H9BNO2 |
| Molecular Weight | 198.01 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | — |
| SMILES | O[B]Oc1ccccc1-c1cccnc1 |
| InChI | InChI=1S/C11H9BNO2/c14-12-15-11-6-2-1-5-10(11)9-4-3-7-13-8-9/h1-8,14H |
| InChIKey | YXPMXIZJUOUWMV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.01 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 172517050 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172517050?
The IUPAC name of CID 172517050 (CID 172517050) is not available.
What is the SMILES notation for CID 172517050?
The canonical SMILES for CID 172517050 is O[B]Oc1ccccc1-c1cccnc1.
What is the InChIKey of CID 172517050?
The InChIKey is YXPMXIZJUOUWMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BNO2/c14-12-15-11-6-2-1-5-10(11)9-4-3-7-13-8-9/h1-8,14H.
What are the key properties of CID 172517050?
CID 172517050 has a molecular weight of 198.01 g/mol, XLogP of 1.65, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172517050 is sourced from PubChem (CID 172517050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).