C28H18F3N3O2 — CID 172517148
1-[3-(2-oxoaziridin-1-yl)-5-[4-[6-[2-(trifluoromethyl)phenyl]-2-pyridinyl]phenyl]phenyl]aziridin-2-one (PubChem CID 172517148) has the molecular formula C28H18F3N3O2 and a molecular weight of 485.47 g/mol. Its IUPAC name is 1-[3-(2-oxoaziridin-1-yl)-5-[4-[6-[2-(trifluoromethyl)phenyl]-2-pyridinyl]phenyl]phenyl]aziridin-2-one.
| Compound Name | 1-[3-(2-oxoaziridin-1-yl)-5-[4-[6-[2-(trifluoromethyl)phenyl]-2-pyridinyl]phenyl]phenyl]aziridin-2-one |
|---|---|
| PubChem CID | 172517148 |
| Molecular Formula | C28H18F3N3O2 |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 1-[3-(2-oxoaziridin-1-yl)-5-[4-[6-[2-(trifluoromethyl)phenyl]-2-pyridinyl]phenyl]phenyl]aziridin-2-one |
| SMILES | O=C1CN1c1cc(-c2ccc(-c3cccc(-c4ccccc4C(F)(F)F)n3)cc2)cc(N2CC2=O)c1 |
| InChI | InChI=1S/C28H18F3N3O2/c29-28(30,31)23-5-2-1-4-22(23)25-7-3-6-24(32-25)18-10-8-17(9-11-18)19-12-20(33-15-26(33)35)14-21(13-19)34-16-27(34)36/h1-14H,15-16H2 |
| InChIKey | QYHDRNMZZKTRQL-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 53.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|