C20H17BrO3 — CID 17251849
(4-bromonaphthalen-1-yl) 2-(2,4-dimethylphenoxy)acetate (PubChem CID 17251849) has the molecular formula C20H17BrO3 and a molecular weight of 385.26 g/mol. Its IUPAC name is (4-bromonaphthalen-1-yl) 2-(2,4-dimethylphenoxy)acetate.
| Compound Name | (4-bromonaphthalen-1-yl) 2-(2,4-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 17251849 |
| Molecular Formula | C20H17BrO3 |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | (4-bromonaphthalen-1-yl) 2-(2,4-dimethylphenoxy)acetate |
| SMILES | Cc1ccc(OCC(=O)Oc2ccc(Br)c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C20H17BrO3/c1-13-7-9-18(14(2)11-13)23-12-20(22)24-19-10-8-17(21)15-5-3-4-6-16(15)19/h3-11H,12H2,1-2H3 |
| InChIKey | YUVMQFUQEOGBDW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|