C51H32N4O — CID 172519929
1,2,3,4,5,6,7-heptadeuterio-8-[4-[4-dibenzofuran-4-yl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-9-(2,3,4,5,6-pentadeuteriophenyl)carbazole (PubChem CID 172519929) has the molecular formula C51H32N4O and a molecular weight of 728.92 g/mol. Its IUPAC name is 1,2,3,4,5,6,7-heptadeuterio-8-[4-[4-dibenzofuran-4-yl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-9-(2,3,4,5,6-pentadeuteriophenyl)carbazole.
| Compound Name | 1,2,3,4,5,6,7-heptadeuterio-8-[4-[4-dibenzofuran-4-yl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-9-(2,3,4,5,6-pentadeuteriophenyl)carbazole |
|---|---|
| PubChem CID | 172519929 |
| Molecular Formula | C51H32N4O |
| Molecular Weight | 728.92 g/mol |
| Exact Mass | 728.33 |
| IUPAC Name | 1,2,3,4,5,6,7-heptadeuterio-8-[4-[4-dibenzofuran-4-yl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-9-(2,3,4,5,6-pentadeuteriophenyl)carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-n2c3c([2H])c([2H])c([2H])c([2H])c3c3c([2H])c([2H])c([2H])c(-c4ccc(-c5nc(-c6ccc(-c7ccccc7)cc6)nc(-c6cccc7c6oc6ccccc67)n5)cc4)c32)c([2H])c1[2H] |
| InChI | InChI=1S/C51H32N4O/c1-3-13-33(14-4-1)34-25-29-36(30-26-34)49-52-50(54-51(53-49)44-22-12-21-43-41-18-8-10-24-46(41)56-48(43)44)37-31-27-35(28-32-37)39-19-11-20-42-40-17-7-9-23-45(40)55(47(39)42)38-15-5-2-6-16-38/h1-32H/i2D,5D,6D,7D,9D,11D,15D,16D,17D,19D,20D,23D |
| InChIKey | NLTAVKLUUOBNCR-FUMUBTNSSA-N |
| XLogP | 13.20 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.92 |
| LogP ≤ 5 | 13.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |