C46H29N3O — CID 176767078
1,2,3,4,5,6,7-heptadeuterio-8-[6-dibenzofuran-2-yl-2-(4-phenylphenyl)pyrimidin-4-yl]-9-(2,3,4,5,6-pentadeuteriophenyl)carbazole (PubChem CID 176767078) has the molecular formula C46H29N3O and a molecular weight of 651.83 g/mol. Its IUPAC name is 1,2,3,4,5,6,7-heptadeuterio-8-[6-dibenzofuran-2-yl-2-(4-phenylphenyl)pyrimidin-4-yl]-9-(2,3,4,5,6-pentadeuteriophenyl)carbazole.
| Compound Name | 1,2,3,4,5,6,7-heptadeuterio-8-[6-dibenzofuran-2-yl-2-(4-phenylphenyl)pyrimidin-4-yl]-9-(2,3,4,5,6-pentadeuteriophenyl)carbazole |
|---|---|
| PubChem CID | 176767078 |
| Molecular Formula | C46H29N3O |
| Molecular Weight | 651.83 g/mol |
| Exact Mass | 651.31 |
| IUPAC Name | 1,2,3,4,5,6,7-heptadeuterio-8-[6-dibenzofuran-2-yl-2-(4-phenylphenyl)pyrimidin-4-yl]-9-(2,3,4,5,6-pentadeuteriophenyl)carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-n2c3c([2H])c([2H])c([2H])c([2H])c3c3c([2H])c([2H])c([2H])c(-c4cc(-c5ccc6oc7ccccc7c6c5)nc(-c5ccc(-c6ccccc6)cc5)n4)c32)c([2H])c1[2H] |
| InChI | InChI=1S/C46H29N3O/c1-3-12-30(13-4-1)31-22-24-32(25-23-31)46-47-40(33-26-27-44-39(28-33)36-17-8-10-21-43(36)50-44)29-41(48-46)38-19-11-18-37-35-16-7-9-20-42(35)49(45(37)38)34-14-5-2-6-15-34/h1-29H/i2D,5D,6D,7D,9D,11D,14D,15D,16D,18D,19D,20D |
| InChIKey | WPPUCGABAWDTQI-OTLVANAKSA-N |
| XLogP | 12.14 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.83 |
| LogP ≤ 5 | 12.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |