C40H25N3O — CID 176767081
1,2,3,4,6,7,8-heptadeuterio-5-(2-dibenzofuran-4-yl-6-phenylpyrimidin-4-yl)-9-(2,3,4,5,6-pentadeuteriophenyl)carbazole (PubChem CID 176767081) has the molecular formula C40H25N3O and a molecular weight of 575.73 g/mol. Its IUPAC name is 1,2,3,4,6,7,8-heptadeuterio-5-(2-dibenzofuran-4-yl-6-phenylpyrimidin-4-yl)-9-(2,3,4,5,6-pentadeuteriophenyl)carbazole.
| Compound Name | 1,2,3,4,6,7,8-heptadeuterio-5-(2-dibenzofuran-4-yl-6-phenylpyrimidin-4-yl)-9-(2,3,4,5,6-pentadeuteriophenyl)carbazole |
|---|---|
| PubChem CID | 176767081 |
| Molecular Formula | C40H25N3O |
| Molecular Weight | 575.73 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | 1,2,3,4,6,7,8-heptadeuterio-5-(2-dibenzofuran-4-yl-6-phenylpyrimidin-4-yl)-9-(2,3,4,5,6-pentadeuteriophenyl)carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-n2c3c([2H])c([2H])c([2H])c([2H])c3c3c(-c4cc(-c5ccccc5)nc(-c5cccc6c5oc5ccccc56)n4)c([2H])c([2H])c([2H])c32)c([2H])c1[2H] |
| InChI | InChI=1S/C40H25N3O/c1-3-13-26(14-4-1)33-25-34(42-40(41-33)32-21-11-19-29-28-17-8-10-24-37(28)44-39(29)32)30-20-12-23-36-38(30)31-18-7-9-22-35(31)43(36)27-15-5-2-6-16-27/h1-25H/i2D,5D,6D,7D,9D,12D,15D,16D,18D,20D,22D,23D |
| InChIKey | DFIZCKPTLWUSSZ-SMKRZXMQSA-N |
| XLogP | 10.47 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.73 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |