C23H20N6O2 — CID 172521695
2-[[(1R)-1-[2-cyano-3-(2-cyanoprop-2-enylamino)-7-methylquinoxalin-5-yl]ethyl]amino]benzoic acid (PubChem CID 172521695) has the molecular formula C23H20N6O2 and a molecular weight of 412.45 g/mol. Its IUPAC name is 2-[[(1R)-1-[2-cyano-3-(2-cyanoprop-2-enylamino)-7-methylquinoxalin-5-yl]ethyl]amino]benzoic acid.
| Compound Name | 2-[[(1R)-1-[2-cyano-3-(2-cyanoprop-2-enylamino)-7-methylquinoxalin-5-yl]ethyl]amino]benzoic acid |
|---|---|
| PubChem CID | 172521695 |
| Molecular Formula | C23H20N6O2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 2-[[(1R)-1-[2-cyano-3-(2-cyanoprop-2-enylamino)-7-methylquinoxalin-5-yl]ethyl]amino]benzoic acid |
| SMILES | C=C(C#N)CNc1nc2c([C@@H](C)Nc3ccccc3C(=O)O)cc(C)cc2nc1C#N |
| InChI | InChI=1S/C23H20N6O2/c1-13-8-17(15(3)27-18-7-5-4-6-16(18)23(30)31)21-19(9-13)28-20(11-25)22(29-21)26-12-14(2)10-24/h4-9,15,27H,2,12H2,1,3H3,(H,26,29)(H,30,31)/t15-/m1/s1 |
| InChIKey | UXWGWGUCPNVKDQ-OAHLLOKOSA-N |
| XLogP | 4.17 |
| TPSA | 134.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|