C17H13IrN4- — CID 172522404
iridium;1-phenyl-3-phenyl-2H-imidazo[4,5-b]pyrazine (PubChem CID 172522404) has the molecular formula C17H13IrN4- and a molecular weight of 465.54 g/mol. Its IUPAC name is iridium;1-phenyl-3-phenyl-2H-imidazo[4,5-b]pyrazine.
| Compound Name | iridium;1-phenyl-3-phenyl-2H-imidazo[4,5-b]pyrazine |
|---|---|
| PubChem CID | 172522404 |
| Molecular Formula | C17H13IrN4- |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | iridium;1-phenyl-3-phenyl-2H-imidazo[4,5-b]pyrazine |
| SMILES | [Ir].[c-]1ccccc1N1CN(c2ccccc2)c2nccnc21 |
| InChI | InChI=1S/C17H13N4.Ir/c1-3-7-14(8-4-1)20-13-21(15-9-5-2-6-10-15)17-16(20)18-11-12-19-17;/h1-9,11-12H,13H2;/q-1; |
| InChIKey | HBKVGHUWWZYKMR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|