C19H18N4 — CID 140758501
1,3-bis(4-methylphenyl)-2H-imidazo[4,5-b]pyrazine (PubChem CID 140758501) has the molecular formula C19H18N4 and a molecular weight of 302.38 g/mol. Its IUPAC name is 1,3-bis(4-methylphenyl)-2H-imidazo[4,5-b]pyrazine.
| Compound Name | 1,3-bis(4-methylphenyl)-2H-imidazo[4,5-b]pyrazine |
|---|---|
| PubChem CID | 140758501 |
| Molecular Formula | C19H18N4 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1,3-bis(4-methylphenyl)-2H-imidazo[4,5-b]pyrazine |
| SMILES | Cc1ccc(N2CN(c3ccc(C)cc3)c3nccnc32)cc1 |
| InChI | InChI=1S/C19H18N4/c1-14-3-7-16(8-4-14)22-13-23(17-9-5-15(2)6-10-17)19-18(22)20-11-12-21-19/h3-12H,13H2,1-2H3 |
| InChIKey | QFJRXXOGIWLJHH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |