C24H23BrN2O4 — CID 17252356
5-bromo-2-(2-methoxyethoxy)-N-[4-[(3-methylbenzoyl)amino]phenyl]benzamide (PubChem CID 17252356) has the molecular formula C24H23BrN2O4 and a molecular weight of 483.36 g/mol. Its IUPAC name is 5-bromo-2-(2-methoxyethoxy)-N-[4-[(3-methylbenzoyl)amino]phenyl]benzamide.
| Compound Name | 5-bromo-2-(2-methoxyethoxy)-N-[4-[(3-methylbenzoyl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 17252356 |
| Molecular Formula | C24H23BrN2O4 |
| Molecular Weight | 483.36 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 5-bromo-2-(2-methoxyethoxy)-N-[4-[(3-methylbenzoyl)amino]phenyl]benzamide |
| SMILES | COCCOc1ccc(Br)cc1C(=O)Nc1ccc(NC(=O)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C24H23BrN2O4/c1-16-4-3-5-17(14-16)23(28)26-19-7-9-20(10-8-19)27-24(29)21-15-18(25)6-11-22(21)31-13-12-30-2/h3-11,14-15H,12-13H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | QYVMSSKOQQOAKB-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.36 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|