C21H25BrN2O3 — CID 17343478
5-bromo-2-hexoxy-N'-(3-methylbenzoyl)benzohydrazide (PubChem CID 17343478) has the molecular formula C21H25BrN2O3 and a molecular weight of 433.35 g/mol. Its IUPAC name is 5-bromo-2-hexoxy-N'-(3-methylbenzoyl)benzohydrazide.
| Compound Name | 5-bromo-2-hexoxy-N'-(3-methylbenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 17343478 |
| Molecular Formula | C21H25BrN2O3 |
| Molecular Weight | 433.35 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 5-bromo-2-hexoxy-N'-(3-methylbenzoyl)benzohydrazide |
| SMILES | CCCCCCOc1ccc(Br)cc1C(=O)NNC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C21H25BrN2O3/c1-3-4-5-6-12-27-19-11-10-17(22)14-18(19)21(26)24-23-20(25)16-9-7-8-15(2)13-16/h7-11,13-14H,3-6,12H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | MSMLCUADOHTMSZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.35 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|