C25H32BrN3O4 — CID 17343509
4-[2-(5-bromo-2-hexoxybenzoyl)hydrazinyl]-N-(2,5-dimethylphenyl)-4-oxobutanamide (PubChem CID 17343509) has the molecular formula C25H32BrN3O4 and a molecular weight of 518.45 g/mol. Its IUPAC name is 4-[2-(5-bromo-2-hexoxybenzoyl)hydrazinyl]-N-(2,5-dimethylphenyl)-4-oxobutanamide.
| Compound Name | 4-[2-(5-bromo-2-hexoxybenzoyl)hydrazinyl]-N-(2,5-dimethylphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 17343509 |
| Molecular Formula | C25H32BrN3O4 |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | 4-[2-(5-bromo-2-hexoxybenzoyl)hydrazinyl]-N-(2,5-dimethylphenyl)-4-oxobutanamide |
| SMILES | CCCCCCOc1ccc(Br)cc1C(=O)NNC(=O)CCC(=O)Nc1cc(C)ccc1C |
| InChI | InChI=1S/C25H32BrN3O4/c1-4-5-6-7-14-33-22-11-10-19(26)16-20(22)25(32)29-28-24(31)13-12-23(30)27-21-15-17(2)8-9-18(21)3/h8-11,15-16H,4-7,12-14H2,1-3H3,(H,27,30)(H,28,31)(H,29,32) |
| InChIKey | FYAKANKPMBHFNO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|