C31H23N — CID 172524272
9-(3-methylphenyl)-3,6-bis(2,3,4,5,6-pentadeuteriophenyl)carbazole (PubChem CID 172524272) has the molecular formula C31H23N and a molecular weight of 419.59 g/mol. Its IUPAC name is 9-(3-methylphenyl)-3,6-bis(2,3,4,5,6-pentadeuteriophenyl)carbazole.
| Compound Name | 9-(3-methylphenyl)-3,6-bis(2,3,4,5,6-pentadeuteriophenyl)carbazole |
|---|---|
| PubChem CID | 172524272 |
| Molecular Formula | C31H23N |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | 9-(3-methylphenyl)-3,6-bis(2,3,4,5,6-pentadeuteriophenyl)carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c(c2)c2cc(-c4c([2H])c([2H])c([2H])c([2H])c4[2H])ccc2n3-c2cccc(C)c2)c([2H])c1[2H] |
| InChI | InChI=1S/C31H23N/c1-22-9-8-14-27(19-22)32-30-17-15-25(23-10-4-2-5-11-23)20-28(30)29-21-26(16-18-31(29)32)24-12-6-3-7-13-24/h2-21H,1H3/i2D,3D,4D,5D,6D,7D,10D,11D,12D,13D |
| InChIKey | ROBNBJIEPREPPK-YJFXVUAJSA-N |
| XLogP | 8.43 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |