C56H39N — CID 172527428
2,3,5,6-tetradeuterio-N-[4-(4-naphthalen-1-ylphenyl)phenyl]-4-(2,3,4,5,6-pentadeuteriophenyl)-N-[4-(2-phenylnaphthalen-1-yl)phenyl]aniline (PubChem CID 172527428) has the molecular formula C56H39N and a molecular weight of 734.99 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-N-[4-(4-naphthalen-1-ylphenyl)phenyl]-4-(2,3,4,5,6-pentadeuteriophenyl)-N-[4-(2-phenylnaphthalen-1-yl)phenyl]aniline.
| Compound Name | 2,3,5,6-tetradeuterio-N-[4-(4-naphthalen-1-ylphenyl)phenyl]-4-(2,3,4,5,6-pentadeuteriophenyl)-N-[4-(2-phenylnaphthalen-1-yl)phenyl]aniline |
|---|---|
| PubChem CID | 172527428 |
| Molecular Formula | C56H39N |
| Molecular Weight | 734.99 g/mol |
| Exact Mass | 734.36 |
| IUPAC Name | 2,3,5,6-tetradeuterio-N-[4-(4-naphthalen-1-ylphenyl)phenyl]-4-(2,3,4,5,6-pentadeuteriophenyl)-N-[4-(2-phenylnaphthalen-1-yl)phenyl]aniline |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c(N(c3ccc(-c4ccc(-c5cccc6ccccc56)cc4)cc3)c3ccc(-c4c(-c5ccccc5)ccc5ccccc45)cc3)c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C56H39N/c1-3-12-40(13-4-1)42-26-33-49(34-27-42)57(50-35-28-43(29-36-50)41-22-24-47(25-23-41)53-21-11-18-44-16-7-9-19-52(44)53)51-37-30-48(31-38-51)56-54-20-10-8-17-46(54)32-39-55(56)45-14-5-2-6-15-45/h1-39H/i1D,3D,4D,12D,13D,26D,27D,33D,34D |
| InChIKey | CWMPCHXQOPWRPQ-JXDTVDBASA-N |
| XLogP | 15.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.99 |
| LogP ≤ 5 | 15.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |