C62H43N — CID 172527562
2,3,5,6-tetradeuterio-N-[4-(4-naphthalen-1-ylphenyl)phenyl]-4-(4-phenylphenyl)-N-[2,3,5,6-tetradeuterio-4-(2-phenylnaphthalen-1-yl)phenyl]aniline (PubChem CID 172527562) has the molecular formula C62H43N and a molecular weight of 810.08 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-N-[4-(4-naphthalen-1-ylphenyl)phenyl]-4-(4-phenylphenyl)-N-[2,3,5,6-tetradeuterio-4-(2-phenylnaphthalen-1-yl)phenyl]aniline.
| Compound Name | 2,3,5,6-tetradeuterio-N-[4-(4-naphthalen-1-ylphenyl)phenyl]-4-(4-phenylphenyl)-N-[2,3,5,6-tetradeuterio-4-(2-phenylnaphthalen-1-yl)phenyl]aniline |
|---|---|
| PubChem CID | 172527562 |
| Molecular Formula | C62H43N |
| Molecular Weight | 810.08 g/mol |
| Exact Mass | 809.39 |
| IUPAC Name | 2,3,5,6-tetradeuterio-N-[4-(4-naphthalen-1-ylphenyl)phenyl]-4-(4-phenylphenyl)-N-[2,3,5,6-tetradeuterio-4-(2-phenylnaphthalen-1-yl)phenyl]aniline |
| SMILES | [2H]c1c([2H])c(N(c2ccc(-c3ccc(-c4cccc5ccccc45)cc3)cc2)c2c([2H])c([2H])c(-c3c(-c4ccccc4)ccc4ccccc34)c([2H])c2[2H])c([2H])c([2H])c1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C62H43N/c1-3-12-44(13-4-1)45-22-24-46(25-23-45)48-30-37-55(38-31-48)63(56-39-32-49(33-40-56)47-26-28-53(29-27-47)59-21-11-18-50-16-7-9-19-58(50)59)57-41-34-54(35-42-57)62-60-20-10-8-17-52(60)36-43-61(62)51-14-5-2-6-15-51/h1-43H/i30D,31D,34D,35D,37D,38D,41D,42D |
| InChIKey | NCKKFBNHMJYZHE-GJRULJTBSA-N |
| XLogP | 17.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.08 |
| LogP ≤ 5 | 17.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |