C64H43N — CID 172527619
2,3,5,6-tetradeuterio-4-(4-naphthalen-1-ylphenyl)-N-(4-phenanthren-2-ylphenyl)-N-[4-(2-phenylnaphthalen-1-yl)phenyl]aniline (PubChem CID 172527619) has the molecular formula C64H43N and a molecular weight of 830.08 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-4-(4-naphthalen-1-ylphenyl)-N-(4-phenanthren-2-ylphenyl)-N-[4-(2-phenylnaphthalen-1-yl)phenyl]aniline.
| Compound Name | 2,3,5,6-tetradeuterio-4-(4-naphthalen-1-ylphenyl)-N-(4-phenanthren-2-ylphenyl)-N-[4-(2-phenylnaphthalen-1-yl)phenyl]aniline |
|---|---|
| PubChem CID | 172527619 |
| Molecular Formula | C64H43N |
| Molecular Weight | 830.08 g/mol |
| Exact Mass | 829.36 |
| IUPAC Name | 2,3,5,6-tetradeuterio-4-(4-naphthalen-1-ylphenyl)-N-(4-phenanthren-2-ylphenyl)-N-[4-(2-phenylnaphthalen-1-yl)phenyl]aniline |
| SMILES | [2H]c1c([2H])c(N(c2ccc(-c3ccc4c(ccc5ccccc54)c3)cc2)c2ccc(-c3c(-c4ccccc4)ccc4ccccc34)cc2)c([2H])c([2H])c1-c1ccc(-c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C64H43N/c1-2-11-48(12-3-1)63-42-33-50-15-6-9-19-62(50)64(63)52-31-39-57(40-32-52)65(56-37-29-46(30-38-56)53-34-41-61-54(43-53)26-25-49-14-5-8-18-59(49)61)55-35-27-45(28-36-55)44-21-23-51(24-22-44)60-20-10-16-47-13-4-7-17-58(47)60/h1-43H/i27D,28D,35D,36D |
| InChIKey | MBHAGEKRGNQJJD-VNJHLPBPSA-N |
| XLogP | 18.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.08 |
| LogP ≤ 5 | 18.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|