C25H23ClN2O4 — CID 172530118
(2S)-3-(4-chloro-N-methylanilino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (PubChem CID 172530118) has the molecular formula C25H23ClN2O4 and a molecular weight of 450.92 g/mol. Its IUPAC name is (2S)-3-(4-chloro-N-methylanilino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid.
| Compound Name | (2S)-3-(4-chloro-N-methylanilino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 172530118 |
| Molecular Formula | C25H23ClN2O4 |
| Molecular Weight | 450.92 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | (2S)-3-(4-chloro-N-methylanilino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| SMILES | CN(C[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H23ClN2O4/c1-28(17-12-10-16(26)11-13-17)14-23(24(29)30)27-25(31)32-15-22-20-8-4-2-6-18(20)19-7-3-5-9-21(19)22/h2-13,22-23H,14-15H2,1H3,(H,27,31)(H,29,30)/t23-/m0/s1 |
| InChIKey | MDWJMMBPTCXQSS-QHCPKHFHSA-N |
| XLogP | 4.77 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.92 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |