C15H12N2O3S — CID 17253078
N-(4-methoxyphenyl)-5-thiophen-2-yl-1,2-oxazole-3-carboxamide (PubChem CID 17253078) has the molecular formula C15H12N2O3S and a molecular weight of 300.34 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-5-thiophen-2-yl-1,2-oxazole-3-carboxamide.
| Compound Name | N-(4-methoxyphenyl)-5-thiophen-2-yl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 17253078 |
| Molecular Formula | C15H12N2O3S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | N-(4-methoxyphenyl)-5-thiophen-2-yl-1,2-oxazole-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc(-c3cccs3)on2)cc1 |
| InChI | InChI=1S/C15H12N2O3S/c1-19-11-6-4-10(5-7-11)16-15(18)12-9-13(20-17-12)14-3-2-8-21-14/h2-9H,1H3,(H,16,18) |
| InChIKey | SPXMCLYTZFOOFM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |