C16H12N2O4S — CID 3238663
methyl 2-[(5-thiophen-2-yl-1,2-oxazole-3-carbonyl)amino]benzoate (PubChem CID 3238663) has the molecular formula C16H12N2O4S and a molecular weight of 328.35 g/mol. Its IUPAC name is methyl 2-[(5-thiophen-2-yl-1,2-oxazole-3-carbonyl)amino]benzoate.
| Compound Name | methyl 2-[(5-thiophen-2-yl-1,2-oxazole-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 3238663 |
| Molecular Formula | C16H12N2O4S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | methyl 2-[(5-thiophen-2-yl-1,2-oxazole-3-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)c1cc(-c2cccs2)on1 |
| InChI | InChI=1S/C16H12N2O4S/c1-21-16(20)10-5-2-3-6-11(10)17-15(19)12-9-13(22-18-12)14-7-4-8-23-14/h2-9H,1H3,(H,17,19) |
| InChIKey | BLELAEUCAXAYAR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |