C32H31N5O2 — CID 172531993
N-(8-methylisoquinolin-1-yl)-3-[5-oxo-5-(pyridin-4-ylamino)pent-1-ynyl]-N-piperidin-3-ylbenzamide (PubChem CID 172531993) has the molecular formula C32H31N5O2 and a molecular weight of 517.63 g/mol. Its IUPAC name is N-(8-methylisoquinolin-1-yl)-3-[5-oxo-5-(pyridin-4-ylamino)pent-1-ynyl]-N-piperidin-3-ylbenzamide.
| Compound Name | N-(8-methylisoquinolin-1-yl)-3-[5-oxo-5-(pyridin-4-ylamino)pent-1-ynyl]-N-piperidin-3-ylbenzamide |
|---|---|
| PubChem CID | 172531993 |
| Molecular Formula | C32H31N5O2 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | N-(8-methylisoquinolin-1-yl)-3-[5-oxo-5-(pyridin-4-ylamino)pent-1-ynyl]-N-piperidin-3-ylbenzamide |
| SMILES | Cc1cccc2ccnc(N(C(=O)c3cccc(C#CCCC(=O)Nc4ccncc4)c3)C3CCCNC3)c12 |
| InChI | InChI=1S/C32H31N5O2/c1-23-7-4-10-25-14-20-35-31(30(23)25)37(28-12-6-17-34-22-28)32(39)26-11-5-9-24(21-26)8-2-3-13-29(38)36-27-15-18-33-19-16-27/h4-5,7,9-11,14-16,18-21,28,34H,3,6,12-13,17,22H2,1H3,(H,33,36,38) |
| InChIKey | VRPPIEBMGNZUPQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|