C9H13ClN2O — CID 172532662
5-(1-chloropiperidin-4-yl)-3-methyl-1,2-oxazole (PubChem CID 172532662) has the molecular formula C9H13ClN2O and a molecular weight of 200.67 g/mol. Its IUPAC name is 5-(1-chloropiperidin-4-yl)-3-methyl-1,2-oxazole.
| Compound Name | 5-(1-chloropiperidin-4-yl)-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 172532662 |
| Molecular Formula | C9H13ClN2O |
| Molecular Weight | 200.67 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 5-(1-chloropiperidin-4-yl)-3-methyl-1,2-oxazole |
| SMILES | Cc1cc(C2CCN(Cl)CC2)on1 |
| InChI | InChI=1S/C9H13ClN2O/c1-7-6-9(13-11-7)8-2-4-12(10)5-3-8/h6,8H,2-5H2,1H3 |
| InChIKey | LUDJTKBZNRIZJQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.67 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|