C9H13NO2 — CID 116869005
3-methyl-5-(oxan-4-yl)-1,2-oxazole (PubChem CID 116869005) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 3-methyl-5-(oxan-4-yl)-1,2-oxazole.
| Compound Name | 3-methyl-5-(oxan-4-yl)-1,2-oxazole |
|---|---|
| PubChem CID | 116869005 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 3-methyl-5-(oxan-4-yl)-1,2-oxazole |
| SMILES | Cc1cc(C2CCOCC2)on1 |
| InChI | InChI=1S/C9H13NO2/c1-7-6-9(12-10-7)8-2-4-11-5-3-8/h6,8H,2-5H2,1H3 |
| InChIKey | DYCPYTPNQVPYAW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |