C21H18ClFIN3O — CID 172532980
N-(8-chloroisoquinolin-1-yl)-2-fluoro-4-iodo-N-[(3R)-piperidin-3-yl]benzamide (PubChem CID 172532980) has the molecular formula C21H18ClFIN3O and a molecular weight of 509.75 g/mol. Its IUPAC name is N-(8-chloroisoquinolin-1-yl)-2-fluoro-4-iodo-N-[(3R)-piperidin-3-yl]benzamide.
| Compound Name | N-(8-chloroisoquinolin-1-yl)-2-fluoro-4-iodo-N-[(3R)-piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 172532980 |
| Molecular Formula | C21H18ClFIN3O |
| Molecular Weight | 509.75 g/mol |
| Exact Mass | 509.02 |
| IUPAC Name | N-(8-chloroisoquinolin-1-yl)-2-fluoro-4-iodo-N-[(3R)-piperidin-3-yl]benzamide |
| SMILES | O=C(c1ccc(I)cc1F)N(c1nccc2cccc(Cl)c12)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C21H18ClFIN3O/c22-17-5-1-3-13-8-10-26-20(19(13)17)27(15-4-2-9-25-12-15)21(28)16-7-6-14(24)11-18(16)23/h1,3,5-8,10-11,15,25H,2,4,9,12H2/t15-/m1/s1 |
| InChIKey | ZVJNMWWPHBIAEP-OAHLLOKOSA-N |
| XLogP | 5.03 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.75 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|