C34H42F4N3O3PS — CID 172535409
(3S,4R)-1-(2,6-dimethyloxan-4-yl)-N-[2-[3-(4-dimethylphosphoryl-2-methoxyanilino)prop-1-ynyl]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-7-yl]-3-fluoropiperidin-4-amine (PubChem CID 172535409) has the molecular formula C34H42F4N3O3PS and a molecular weight of 679.76 g/mol. Its IUPAC name is (3S,4R)-1-(2,6-dimethyloxan-4-yl)-N-[2-[3-(4-dimethylphosphoryl-2-methoxyanilino)prop-1-ynyl]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-7-yl]-3-fluoropiperidin-4-amine.
| Compound Name | (3S,4R)-1-(2,6-dimethyloxan-4-yl)-N-[2-[3-(4-dimethylphosphoryl-2-methoxyanilino)prop-1-ynyl]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-7-yl]-3-fluoropiperidin-4-amine |
|---|---|
| PubChem CID | 172535409 |
| Molecular Formula | C34H42F4N3O3PS |
| Molecular Weight | 679.76 g/mol |
| Exact Mass | 679.26 |
| IUPAC Name | (3S,4R)-1-(2,6-dimethyloxan-4-yl)-N-[2-[3-(4-dimethylphosphoryl-2-methoxyanilino)prop-1-ynyl]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-7-yl]-3-fluoropiperidin-4-amine |
| SMILES | COc1cc(P(C)(C)=O)ccc1NCC#Cc1sc2c(N[C@@H]3CCN(C4CC(C)OC(C)C4)C[C@@H]3F)cccc2c1CC(F)(F)F |
| InChI | InChI=1S/C34H42F4N3O3PS/c1-21-16-23(17-22(2)44-21)41-15-13-28(27(35)20-41)40-30-9-6-8-25-26(19-34(36,37)38)32(46-33(25)30)10-7-14-39-29-12-11-24(45(4,5)42)18-31(29)43-3/h6,8-9,11-12,18,21-23,27-28,39-40H,13-17,19-20H2,1-5H3/t21?,22?,23?,27-,28+/m0/s1 |
| InChIKey | MMCMTKWPGRYZKE-FJXIBAFOSA-N |
| XLogP | 7.51 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.76 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|