C32H34F2N3O2PS — CID 172536000
(3S,4S)-N-[2-[3-(4-dimethylphosphoryl-2-methoxyanilino)prop-1-ynyl]-3-(4-fluorophenyl)-1-benzothiophen-7-yl]-3-fluoro-1-methylpiperidin-4-amine (PubChem CID 172536000) has the molecular formula C32H34F2N3O2PS and a molecular weight of 593.68 g/mol. Its IUPAC name is (3S,4S)-N-[2-[3-(4-dimethylphosphoryl-2-methoxyanilino)prop-1-ynyl]-3-(4-fluorophenyl)-1-benzothiophen-7-yl]-3-fluoro-1-methylpiperidin-4-amine.
| Compound Name | (3S,4S)-N-[2-[3-(4-dimethylphosphoryl-2-methoxyanilino)prop-1-ynyl]-3-(4-fluorophenyl)-1-benzothiophen-7-yl]-3-fluoro-1-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 172536000 |
| Molecular Formula | C32H34F2N3O2PS |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.21 |
| IUPAC Name | (3S,4S)-N-[2-[3-(4-dimethylphosphoryl-2-methoxyanilino)prop-1-ynyl]-3-(4-fluorophenyl)-1-benzothiophen-7-yl]-3-fluoro-1-methylpiperidin-4-amine |
| SMILES | COc1cc(P(C)(C)=O)ccc1NCC#Cc1sc2c(N[C@H]3CCN(C)C[C@@H]3F)cccc2c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C32H34F2N3O2PS/c1-37-18-16-26(25(34)20-37)36-28-8-5-7-24-31(21-10-12-22(33)13-11-21)30(41-32(24)28)9-6-17-35-27-15-14-23(40(3,4)38)19-29(27)39-2/h5,7-8,10-15,19,25-26,35-36H,16-18,20H2,1-4H3/t25-,26-/m0/s1 |
| InChIKey | CKCIRMGTEMRBQY-UIOOFZCWSA-N |
| XLogP | 6.88 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|