About 1-azido-7,7-dimethyloct-4-yne
1-azido-7,7-dimethyloct-4-yne (PubChem CID 172538578) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is 1-azido-7,7-dimethyloct-4-yne.
Molecular Properties
| Compound Name | 1-azido-7,7-dimethyloct-4-yne |
| PubChem CID | 172538578 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 1-azido-7,7-dimethyloct-4-yne |
| SMILES | CC(C)(C)CC#CCCCN=[N+]=[N-] |
| InChI | InChI=1S/C10H17N3/c1-10(2,3)8-6-4-5-7-9-12-13-11/h5,7-9H2,1-3H3 |
| InChIKey | SCJWZIXEMGILKI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-azido-7,7-dimethyloct-4-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azido-7,7-dimethyloct-4-yne?
The IUPAC name of 1-azido-7,7-dimethyloct-4-yne (CID 172538578) is 1-azido-7,7-dimethyloct-4-yne.
What is the SMILES notation for 1-azido-7,7-dimethyloct-4-yne?
The canonical SMILES for 1-azido-7,7-dimethyloct-4-yne is CC(C)(C)CC#CCCCN=[N+]=[N-].
What is the InChIKey of 1-azido-7,7-dimethyloct-4-yne?
The InChIKey is SCJWZIXEMGILKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3/c1-10(2,3)8-6-4-5-7-9-12-13-11/h5,7-9H2,1-3H3.
What are the key properties of 1-azido-7,7-dimethyloct-4-yne?
1-azido-7,7-dimethyloct-4-yne has a molecular weight of 179.27 g/mol, XLogP of 3.52, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azido-7,7-dimethyloct-4-yne is sourced from PubChem (CID 172538578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).