About 5-azido-2,2-dimethylpentanenitrile
5-azido-2,2-dimethylpentanenitrile (PubChem CID 65255997) has the molecular formula C7H12N4
and a molecular weight of 152.20 g/mol. Its IUPAC name is 5-azido-2,2-dimethylpentanenitrile.
Molecular Properties
| Compound Name | 5-azido-2,2-dimethylpentanenitrile |
| PubChem CID | 65255997 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 5-azido-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCN=[N+]=[N-] |
| InChI | InChI=1S/C7H12N4/c1-7(2,6-8)4-3-5-10-11-9/h3-5H2,1-2H3 |
| InChIKey | XHPDZVQGHWDSGC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 72.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 5-azido-2,2-dimethylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-azido-2,2-dimethylpentanenitrile?
The IUPAC name of 5-azido-2,2-dimethylpentanenitrile (CID 65255997) is 5-azido-2,2-dimethylpentanenitrile.
What is the SMILES notation for 5-azido-2,2-dimethylpentanenitrile?
The canonical SMILES for 5-azido-2,2-dimethylpentanenitrile is CC(C)(C#N)CCCN=[N+]=[N-].
What is the InChIKey of 5-azido-2,2-dimethylpentanenitrile?
The InChIKey is XHPDZVQGHWDSGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4/c1-7(2,6-8)4-3-5-10-11-9/h3-5H2,1-2H3.
What are the key properties of 5-azido-2,2-dimethylpentanenitrile?
5-azido-2,2-dimethylpentanenitrile has a molecular weight of 152.20 g/mol, XLogP of 2.63, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-azido-2,2-dimethylpentanenitrile is sourced from PubChem (CID 65255997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).