C27H22ClF3NO4+ — CID 172539254
[(1S)-1-carboxy-3-[3-chloro-4-(trifluoromethyl)phenyl]propyl]-(9H-fluoren-9-ylmethoxycarbonyl)-methylideneazanium (PubChem CID 172539254) has the molecular formula C27H22ClF3NO4+ and a molecular weight of 516.92 g/mol. Its IUPAC name is [(1S)-1-carboxy-3-[3-chloro-4-(trifluoromethyl)phenyl]propyl]-(9H-fluoren-9-ylmethoxycarbonyl)-methylideneazanium.
| Compound Name | [(1S)-1-carboxy-3-[3-chloro-4-(trifluoromethyl)phenyl]propyl]-(9H-fluoren-9-ylmethoxycarbonyl)-methylideneazanium |
|---|---|
| PubChem CID | 172539254 |
| Molecular Formula | C27H22ClF3NO4+ |
| Molecular Weight | 516.92 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | [(1S)-1-carboxy-3-[3-chloro-4-(trifluoromethyl)phenyl]propyl]-(9H-fluoren-9-ylmethoxycarbonyl)-methylideneazanium |
| SMILES | C=[N+](C(=O)OCC1c2ccccc2-c2ccccc21)[C@@H](CCc1ccc(C(F)(F)F)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C27H21ClF3NO4/c1-32(24(25(33)34)13-11-16-10-12-22(23(28)14-16)27(29,30)31)26(35)36-15-21-19-8-4-2-6-17(19)18-7-3-5-9-20(18)21/h2-10,12,14,21,24H,1,11,13,15H2/p+1/t24-/m0/s1 |
| InChIKey | UWWSYDYJSBWFOB-DEOSSOPVSA-O |
| XLogP | 6.41 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.92 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|