C23H22N2O5 — CID 17253942
2-[[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]methoxy]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide (PubChem CID 17253942) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is 2-[[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]methoxy]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide.
| Compound Name | 2-[[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]methoxy]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 17253942 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 2-[[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]methoxy]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
| SMILES | O=C(COCc1cc(-c2ccc3c(c2)OCO3)on1)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C23H22N2O5/c26-23(24-19-7-3-5-15-4-1-2-6-18(15)19)13-27-12-17-11-21(30-25-17)16-8-9-20-22(10-16)29-14-28-20/h1-2,4,6,8-11,19H,3,5,7,12-14H2,(H,24,26) |
| InChIKey | RVRJWCGDSDRADP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |