C25H32ClN7O2 — CID 172540424
N-[2-[3-amino-4-(ethoxymethyl)pyrrolidin-1-yl]-5,6,7,8-tetrahydroquinolin-6-yl]-5-chloro-7-ethylpyrrolo[2,3-c]pyridazine-3-carboxamide (PubChem CID 172540424) has the molecular formula C25H32ClN7O2 and a molecular weight of 498.03 g/mol. Its IUPAC name is N-[2-[3-amino-4-(ethoxymethyl)pyrrolidin-1-yl]-5,6,7,8-tetrahydroquinolin-6-yl]-5-chloro-7-ethylpyrrolo[2,3-c]pyridazine-3-carboxamide.
| Compound Name | N-[2-[3-amino-4-(ethoxymethyl)pyrrolidin-1-yl]-5,6,7,8-tetrahydroquinolin-6-yl]-5-chloro-7-ethylpyrrolo[2,3-c]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 172540424 |
| Molecular Formula | C25H32ClN7O2 |
| Molecular Weight | 498.03 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | N-[2-[3-amino-4-(ethoxymethyl)pyrrolidin-1-yl]-5,6,7,8-tetrahydroquinolin-6-yl]-5-chloro-7-ethylpyrrolo[2,3-c]pyridazine-3-carboxamide |
| SMILES | CCOCC1CN(c2ccc3c(n2)CCC(NC(=O)c2cc4c(Cl)cn(CC)c4nn2)C3)CC1N |
| InChI | InChI=1S/C25H32ClN7O2/c1-3-32-12-19(26)18-10-22(30-31-24(18)32)25(34)28-17-6-7-21-15(9-17)5-8-23(29-21)33-11-16(14-35-4-2)20(27)13-33/h5,8,10,12,16-17,20H,3-4,6-7,9,11,13-14,27H2,1-2H3,(H,28,34) |
| InChIKey | YYDVEPJCWBCYLR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.03 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |