C27H36ClN7O3 — CID 172539840
N-[2-[3-amino-4-(3-methoxybutan-2-yloxy)pyrrolidin-1-yl]-5,6,7,8-tetrahydroquinolin-6-yl]-5-chloro-7-ethylpyrrolo[2,3-c]pyridazine-3-carboxamide (PubChem CID 172539840) has the molecular formula C27H36ClN7O3 and a molecular weight of 542.08 g/mol. Its IUPAC name is N-[2-[3-amino-4-(3-methoxybutan-2-yloxy)pyrrolidin-1-yl]-5,6,7,8-tetrahydroquinolin-6-yl]-5-chloro-7-ethylpyrrolo[2,3-c]pyridazine-3-carboxamide.
| Compound Name | N-[2-[3-amino-4-(3-methoxybutan-2-yloxy)pyrrolidin-1-yl]-5,6,7,8-tetrahydroquinolin-6-yl]-5-chloro-7-ethylpyrrolo[2,3-c]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 172539840 |
| Molecular Formula | C27H36ClN7O3 |
| Molecular Weight | 542.08 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | N-[2-[3-amino-4-(3-methoxybutan-2-yloxy)pyrrolidin-1-yl]-5,6,7,8-tetrahydroquinolin-6-yl]-5-chloro-7-ethylpyrrolo[2,3-c]pyridazine-3-carboxamide |
| SMILES | CCn1cc(Cl)c2cc(C(=O)NC3CCc4nc(N5CC(N)C(OC(C)C(C)OC)C5)ccc4C3)nnc21 |
| InChI | InChI=1S/C27H36ClN7O3/c1-5-34-12-20(28)19-11-23(32-33-26(19)34)27(36)30-18-7-8-22-17(10-18)6-9-25(31-22)35-13-21(29)24(14-35)38-16(3)15(2)37-4/h6,9,11-12,15-16,18,21,24H,5,7-8,10,13-14,29H2,1-4H3,(H,30,36) |
| InChIKey | CXIUKUKUYSUWKQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.08 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |