C20H18N2O3S — CID 172542171
[6-(1,2-benzoxazol-5-yl)thieno[2,3-b]pyridin-2-yl]-(oxan-4-yl)methanol (PubChem CID 172542171) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is [6-(1,2-benzoxazol-5-yl)thieno[2,3-b]pyridin-2-yl]-(oxan-4-yl)methanol.
| Compound Name | [6-(1,2-benzoxazol-5-yl)thieno[2,3-b]pyridin-2-yl]-(oxan-4-yl)methanol |
|---|---|
| PubChem CID | 172542171 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | [6-(1,2-benzoxazol-5-yl)thieno[2,3-b]pyridin-2-yl]-(oxan-4-yl)methanol |
| SMILES | OC(c1cc2ccc(-c3ccc4oncc4c3)nc2s1)C1CCOCC1 |
| InChI | InChI=1S/C20H18N2O3S/c23-19(12-5-7-24-8-6-12)18-10-14-1-3-16(22-20(14)26-18)13-2-4-17-15(9-13)11-21-25-17/h1-4,9-12,19,23H,5-8H2 |
| InChIKey | YPTWIKXZFBCZKX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |