C13H17ClN4S — CID 172542987
7-chloro-N-(1-ethylpiperidin-3-yl)thieno[2,3-d]pyridazin-4-amine (PubChem CID 172542987) has the molecular formula C13H17ClN4S and a molecular weight of 296.83 g/mol. Its IUPAC name is 7-chloro-N-(1-ethylpiperidin-3-yl)thieno[2,3-d]pyridazin-4-amine.
| Compound Name | 7-chloro-N-(1-ethylpiperidin-3-yl)thieno[2,3-d]pyridazin-4-amine |
|---|---|
| PubChem CID | 172542987 |
| Molecular Formula | C13H17ClN4S |
| Molecular Weight | 296.83 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 7-chloro-N-(1-ethylpiperidin-3-yl)thieno[2,3-d]pyridazin-4-amine |
| SMILES | CCN1CCCC(Nc2nnc(Cl)c3sccc23)C1 |
| InChI | InChI=1S/C13H17ClN4S/c1-2-18-6-3-4-9(8-18)15-13-10-5-7-19-11(10)12(14)16-17-13/h5,7,9H,2-4,6,8H2,1H3,(H,15,17) |
| InChIKey | AYSBLUZZXVXYQL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.83 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |