C20H34O4 — CID 172546298
hex-1-en-3-yl (E)-2-ethyl-7-(2-methylbutanoyloxy)hept-5-enoate (PubChem CID 172546298) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is hex-1-en-3-yl (E)-2-ethyl-7-(2-methylbutanoyloxy)hept-5-enoate.
| Compound Name | hex-1-en-3-yl (E)-2-ethyl-7-(2-methylbutanoyloxy)hept-5-enoate |
|---|---|
| PubChem CID | 172546298 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | hex-1-en-3-yl (E)-2-ethyl-7-(2-methylbutanoyloxy)hept-5-enoate |
| SMILES | C=CC(CCC)OC(=O)C(CC)CC/C=C/COC(=O)C(C)CC |
| InChI | InChI=1S/C20H34O4/c1-6-13-18(9-4)24-20(22)17(8-3)14-11-10-12-15-23-19(21)16(5)7-2/h9-10,12,16-18H,4,6-8,11,13-15H2,1-3,5H3/b12-10+ |
| InChIKey | BQYLOAQLQOYPJH-ZRDIBKRKSA-N |
| XLogP | 4.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|