C31H44N4O5S — CID 172546492
[(3R,5S)-1-[2-(3,3-dimethylbutanoylamino)-3,3-dimethylbutanoyl]-5-[[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]carbamoyl]pyrrolidin-3-yl] acetate (PubChem CID 172546492) has the molecular formula C31H44N4O5S and a molecular weight of 584.78 g/mol. Its IUPAC name is [(3R,5S)-1-[2-(3,3-dimethylbutanoylamino)-3,3-dimethylbutanoyl]-5-[[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]carbamoyl]pyrrolidin-3-yl] acetate.
| Compound Name | [(3R,5S)-1-[2-(3,3-dimethylbutanoylamino)-3,3-dimethylbutanoyl]-5-[[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]carbamoyl]pyrrolidin-3-yl] acetate |
|---|---|
| PubChem CID | 172546492 |
| Molecular Formula | C31H44N4O5S |
| Molecular Weight | 584.78 g/mol |
| Exact Mass | 584.30 |
| IUPAC Name | [(3R,5S)-1-[2-(3,3-dimethylbutanoylamino)-3,3-dimethylbutanoyl]-5-[[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]carbamoyl]pyrrolidin-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H](C(=O)N[C@@H](C)c2ccc(-c3scnc3C)cc2)N(C(=O)C(NC(=O)CC(C)(C)C)C(C)(C)C)C1 |
| InChI | InChI=1S/C31H44N4O5S/c1-18(21-10-12-22(13-11-21)26-19(2)32-17-41-26)33-28(38)24-14-23(40-20(3)36)16-35(24)29(39)27(31(7,8)9)34-25(37)15-30(4,5)6/h10-13,17-18,23-24,27H,14-16H2,1-9H3,(H,33,38)(H,34,37)/t18-,23+,24-,27?/m0/s1 |
| InChIKey | OANWZKPTWSVWOR-IBDDVBMPSA-N |
| XLogP | 4.80 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.78 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |