C20H27N3O5 — CID 172548832
2,2-dimethylpropanoyloxymethyl 4-(4-aminobutanoylamino)-2-(3-aminoprop-1-ynyl)benzoate (PubChem CID 172548832) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl 4-(4-aminobutanoylamino)-2-(3-aminoprop-1-ynyl)benzoate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl 4-(4-aminobutanoylamino)-2-(3-aminoprop-1-ynyl)benzoate |
|---|---|
| PubChem CID | 172548832 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl 4-(4-aminobutanoylamino)-2-(3-aminoprop-1-ynyl)benzoate |
| SMILES | CC(C)(C)C(=O)OCOC(=O)c1ccc(NC(=O)CCCN)cc1C#CCN |
| InChI | InChI=1S/C20H27N3O5/c1-20(2,3)19(26)28-13-27-18(25)16-9-8-15(12-14(16)6-4-10-21)23-17(24)7-5-11-22/h8-9,12H,5,7,10-11,13,21-22H2,1-3H3,(H,23,24) |
| InChIKey | FSTOSMRNAXGJCV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|