C15H19F3N4O2 — CID 172550683
5-oxo-2-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]hexanal (PubChem CID 172550683) has the molecular formula C15H19F3N4O2 and a molecular weight of 344.34 g/mol. Its IUPAC name is 5-oxo-2-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]hexanal.
| Compound Name | 5-oxo-2-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]hexanal |
|---|---|
| PubChem CID | 172550683 |
| Molecular Formula | C15H19F3N4O2 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 5-oxo-2-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]hexanal |
| SMILES | CC(=O)CCC(C=O)N1CCN(c2ncc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C15H19F3N4O2/c1-11(24)2-3-13(10-23)21-4-6-22(7-5-21)14-19-8-12(9-20-14)15(16,17)18/h8-10,13H,2-7H2,1H3 |
| InChIKey | YMFFHQVYTDCMLK-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|