About 4-chloro-2-[(1E)-4-oxobuta-1,3-dienyl]benzaldehyde
4-chloro-2-[(1E)-4-oxobuta-1,3-dienyl]benzaldehyde (PubChem CID 172555490) has the molecular formula C11H7ClO2
and a molecular weight of 206.63 g/mol. Its IUPAC name is 4-chloro-2-[(1E)-4-oxobuta-1,3-dienyl]benzaldehyde.
Molecular Properties
| Compound Name | 4-chloro-2-[(1E)-4-oxobuta-1,3-dienyl]benzaldehyde |
| PubChem CID | 172555490 |
| Molecular Formula | C11H7ClO2 |
| Molecular Weight | 206.63 g/mol |
| Exact Mass | 206.01 |
| IUPAC Name | 4-chloro-2-[(1E)-4-oxobuta-1,3-dienyl]benzaldehyde |
| SMILES | O=C=C/C=C/c1cc(Cl)ccc1C=O |
| InChI | InChI=1S/C11H7ClO2/c12-11-5-4-10(8-14)9(7-11)3-1-2-6-13/h1-5,7-8H/b3-1+ |
| InChIKey | JGFDOKNPOXPROB-HNQUOIGGSA-N |
| XLogP | 2.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.63 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-[(1E)-4-oxobuta-1,3-dienyl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-[(1E)-4-oxobuta-1,3-dienyl]benzaldehyde?
The IUPAC name of 4-chloro-2-[(1E)-4-oxobuta-1,3-dienyl]benzaldehyde (CID 172555490) is 4-chloro-2-[(1E)-4-oxobuta-1,3-dienyl]benzaldehyde.
What is the SMILES notation for 4-chloro-2-[(1E)-4-oxobuta-1,3-dienyl]benzaldehyde?
The canonical SMILES for 4-chloro-2-[(1E)-4-oxobuta-1,3-dienyl]benzaldehyde is O=C=C/C=C/c1cc(Cl)ccc1C=O.
What is the InChIKey of 4-chloro-2-[(1E)-4-oxobuta-1,3-dienyl]benzaldehyde?
The InChIKey is JGFDOKNPOXPROB-HNQUOIGGSA-N. The full InChI is InChI=1S/C11H7ClO2/c12-11-5-4-10(8-14)9(7-11)3-1-2-6-13/h1-5,7-8H/b3-1+.
What are the key properties of 4-chloro-2-[(1E)-4-oxobuta-1,3-dienyl]benzaldehyde?
4-chloro-2-[(1E)-4-oxobuta-1,3-dienyl]benzaldehyde has a molecular weight of 206.63 g/mol, XLogP of 2.55, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-[(1E)-4-oxobuta-1,3-dienyl]benzaldehyde is sourced from PubChem (CID 172555490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).