About 6-carbamoylhept-6-enoic acid
6-carbamoylhept-6-enoic acid (PubChem CID 172557406) has the molecular formula C8H13NO3
and a molecular weight of 171.20 g/mol. Its IUPAC name is 6-carbamoylhept-6-enoic acid.
Molecular Properties
| Compound Name | 6-carbamoylhept-6-enoic acid |
| PubChem CID | 172557406 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 6-carbamoylhept-6-enoic acid |
| SMILES | C=C(CCCCC(=O)O)C(N)=O |
| InChI | InChI=1S/C8H13NO3/c1-6(8(9)12)4-2-3-5-7(10)11/h1-5H2,(H2,9,12)(H,10,11) |
| InChIKey | HAUSFDJOKXZFRN-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-carbamoylhept-6-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-carbamoylhept-6-enoic acid?
The IUPAC name of 6-carbamoylhept-6-enoic acid (CID 172557406) is 6-carbamoylhept-6-enoic acid.
What is the SMILES notation for 6-carbamoylhept-6-enoic acid?
The canonical SMILES for 6-carbamoylhept-6-enoic acid is C=C(CCCCC(=O)O)C(N)=O.
What is the InChIKey of 6-carbamoylhept-6-enoic acid?
The InChIKey is HAUSFDJOKXZFRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3/c1-6(8(9)12)4-2-3-5-7(10)11/h1-5H2,(H2,9,12)(H,10,11).
What are the key properties of 6-carbamoylhept-6-enoic acid?
6-carbamoylhept-6-enoic acid has a molecular weight of 171.20 g/mol, XLogP of 0.67, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-carbamoylhept-6-enoic acid is sourced from PubChem (CID 172557406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).