About ethene;hexanedioic acid
ethene;hexanedioic acid (PubChem CID 173462672) has the molecular formula C18H34O4
and a molecular weight of 314.47 g/mol. Its IUPAC name is ethene;hexanedioic acid.
Molecular Properties
| Compound Name | ethene;hexanedioic acid |
| PubChem CID | 173462672 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | ethene;hexanedioic acid |
| SMILES | C=C.C=C.C=C.C=C.C=C.C=C.O=C(O)CCCCC(=O)O |
| InChI | InChI=1S/C6H10O4.6C2H4/c7-5(8)3-1-2-4-6(9)10;6*1-2/h1-4H2,(H,7,8)(H,9,10);6*1-2H2 |
| InChIKey | YFZMOUXOAWQSJA-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;hexanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;hexanedioic acid?
The IUPAC name of ethene;hexanedioic acid (CID 173462672) is ethene;hexanedioic acid.
What is the SMILES notation for ethene;hexanedioic acid?
The canonical SMILES for ethene;hexanedioic acid is C=C.C=C.C=C.C=C.C=C.C=C.O=C(O)CCCCC(=O)O.
What is the InChIKey of ethene;hexanedioic acid?
The InChIKey is YFZMOUXOAWQSJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4.6C2H4/c7-5(8)3-1-2-4-6(9)10;6*1-2/h1-4H2,(H,7,8)(H,9,10);6*1-2H2.
What are the key properties of ethene;hexanedioic acid?
ethene;hexanedioic acid has a molecular weight of 314.47 g/mol, XLogP of 5.53, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;hexanedioic acid is sourced from PubChem (CID 173462672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).