C7H9F5O2 — CID 172557409
2-methyl-2-(2,2,3,3,3-pentafluoropropoxymethyl)oxirane (PubChem CID 172557409) has the molecular formula C7H9F5O2 and a molecular weight of 220.14 g/mol. Its IUPAC name is 2-methyl-2-(2,2,3,3,3-pentafluoropropoxymethyl)oxirane.
| Compound Name | 2-methyl-2-(2,2,3,3,3-pentafluoropropoxymethyl)oxirane |
|---|---|
| PubChem CID | 172557409 |
| Molecular Formula | C7H9F5O2 |
| Molecular Weight | 220.14 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 2-methyl-2-(2,2,3,3,3-pentafluoropropoxymethyl)oxirane |
| SMILES | CC1(COCC(F)(F)C(F)(F)F)CO1 |
| InChI | InChI=1S/C7H9F5O2/c1-5(3-14-5)2-13-4-6(8,9)7(10,11)12/h2-4H2,1H3 |
| InChIKey | WQWFWDBQNHNMJR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.14 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|