C10H16N3O8PS — CID 172561108
4-amino-1-[(2R,3S,4R,5R)-4-dihydroxyphosphinothioyloxy-3-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]pyrimidin-2-one (PubChem CID 172561108) has the molecular formula C10H16N3O8PS and a molecular weight of 369.29 g/mol. Its IUPAC name is 4-amino-1-[(2R,3S,4R,5R)-4-dihydroxyphosphinothioyloxy-3-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3S,4R,5R)-4-dihydroxyphosphinothioyloxy-3-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 172561108 |
| Molecular Formula | C10H16N3O8PS |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 4-amino-1-[(2R,3S,4R,5R)-4-dihydroxyphosphinothioyloxy-3-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]pyrimidin-2-one |
| SMILES | CO[C@@]1(O)[C@H](OP(O)(O)=S)[C@@H](CO)O[C@H]1n1ccc(N)nc1=O |
| InChI | InChI=1S/C10H16N3O8PS/c1-19-10(16)7(21-22(17,18)23)5(4-14)20-8(10)13-3-2-6(11)12-9(13)15/h2-3,5,7-8,14,16H,4H2,1H3,(H2,11,12,15)(H2,17,18,23)/t5-,7-,8-,10+/m1/s1 |
| InChIKey | QBGHUYUTOJINPQ-UZRKRJFESA-N |
| XLogP | -2.36 |
| TPSA | 169.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|