C14H14ClFN4Si — CID 172561393
[6-chloro-3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-7-yl]-trimethylsilane (PubChem CID 172561393) has the molecular formula C14H14ClFN4Si and a molecular weight of 320.83 g/mol. Its IUPAC name is [6-chloro-3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-7-yl]-trimethylsilane.
| Compound Name | [6-chloro-3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-7-yl]-trimethylsilane |
|---|---|
| PubChem CID | 172561393 |
| Molecular Formula | C14H14ClFN4Si |
| Molecular Weight | 320.83 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | [6-chloro-3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-7-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1cc2nnc(-c3ccc(F)cc3)n2nc1Cl |
| InChI | InChI=1S/C14H14ClFN4Si/c1-21(2,3)11-8-12-17-18-14(20(12)19-13(11)15)9-4-6-10(16)7-5-9/h4-8H,1-3H3 |
| InChIKey | RQAPIFMYMOWSHE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.83 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|