C48H92O2 — CID 172562042
2,6,10,15,19,23-hexamethyltetracosyl (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 172562042) has the molecular formula C48H92O2 and a molecular weight of 701.26 g/mol. Its IUPAC name is 2,6,10,15,19,23-hexamethyltetracosyl (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | 2,6,10,15,19,23-hexamethyltetracosyl (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 172562042 |
| Molecular Formula | C48H92O2 |
| Molecular Weight | 701.26 g/mol |
| Exact Mass | 700.71 |
| IUPAC Name | 2,6,10,15,19,23-hexamethyltetracosyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(C)CCCC(C)CCCC(C)CCCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C48H92O2/c1-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-40-48(49)50-41-47(8)39-29-38-46(7)37-28-35-44(5)32-25-24-31-43(4)34-27-36-45(6)33-26-30-42(2)3/h13-14,16-17,42-47H,9-12,15,18-41H2,1-8H3/b14-13-,17-16- |
| InChIKey | ZPZXOCVONAWESW-AUGURXLVSA-N |
| XLogP | 16.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.26 |
| LogP ≤ 5 | 16.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|