C42H32N2O12S2 — CID 172563398
(6-hex-1-ynyl-1,3-dioxobenzo[de]isoquinolin-2-yl) [3-(6-hex-1-ynyl-1,3-dioxobenzo[de]isoquinolin-2-yl)oxysulfonyloxyphenyl] sulfate (PubChem CID 172563398) has the molecular formula C42H32N2O12S2 and a molecular weight of 820.85 g/mol. Its IUPAC name is (6-hex-1-ynyl-1,3-dioxobenzo[de]isoquinolin-2-yl) [3-(6-hex-1-ynyl-1,3-dioxobenzo[de]isoquinolin-2-yl)oxysulfonyloxyphenyl] sulfate.
| Compound Name | (6-hex-1-ynyl-1,3-dioxobenzo[de]isoquinolin-2-yl) [3-(6-hex-1-ynyl-1,3-dioxobenzo[de]isoquinolin-2-yl)oxysulfonyloxyphenyl] sulfate |
|---|---|
| PubChem CID | 172563398 |
| Molecular Formula | C42H32N2O12S2 |
| Molecular Weight | 820.85 g/mol |
| Exact Mass | 820.14 |
| IUPAC Name | (6-hex-1-ynyl-1,3-dioxobenzo[de]isoquinolin-2-yl) [3-(6-hex-1-ynyl-1,3-dioxobenzo[de]isoquinolin-2-yl)oxysulfonyloxyphenyl] sulfate |
| SMILES | CCCCC#Cc1ccc2c3c(cccc13)C(=O)N(OS(=O)(=O)Oc1cccc(OS(=O)(=O)ON3C(=O)c4cccc5c(C#CCCCC)ccc(c45)C3=O)c1)C2=O |
| InChI | InChI=1S/C42H32N2O12S2/c1-3-5-7-9-14-27-22-24-35-37-31(27)18-12-20-33(37)39(45)43(41(35)47)55-57(49,50)53-29-16-11-17-30(26-29)54-58(51,52)56-44-40(46)34-21-13-19-32-28(15-10-8-6-4-2)23-25-36(38(32)34)42(44)48/h11-13,16-26H,3-8H2,1-2H3 |
| InChIKey | IYLDWACTMJYQBP-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 179.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.85 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|