C20H17NO6S — CID 172563369
(1,3-dioxobenzo[de]isoquinolin-2-yl) phenyl sulfate;ethane (PubChem CID 172563369) has the molecular formula C20H17NO6S and a molecular weight of 399.42 g/mol. Its IUPAC name is (1,3-dioxobenzo[de]isoquinolin-2-yl) phenyl sulfate;ethane.
| Compound Name | (1,3-dioxobenzo[de]isoquinolin-2-yl) phenyl sulfate;ethane |
|---|---|
| PubChem CID | 172563369 |
| Molecular Formula | C20H17NO6S |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | (1,3-dioxobenzo[de]isoquinolin-2-yl) phenyl sulfate;ethane |
| SMILES | CC.O=C1c2cccc3cccc(c23)C(=O)N1OS(=O)(=O)Oc1ccccc1 |
| InChI | InChI=1S/C18H11NO6S.C2H6/c20-17-14-10-4-6-12-7-5-11-15(16(12)14)18(21)19(17)25-26(22,23)24-13-8-2-1-3-9-13;1-2/h1-11H;1-2H3 |
| InChIKey | AXWTWTVDMGBKGK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|