C18H6F5NO4 — CID 163865535
2-(2,3,4,5,6-pentafluorophenyl)peroxybenzo[de]isoquinoline-1,3-dione (PubChem CID 163865535) has the molecular formula C18H6F5NO4 and a molecular weight of 395.24 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentafluorophenyl)peroxybenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(2,3,4,5,6-pentafluorophenyl)peroxybenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 163865535 |
| Molecular Formula | C18H6F5NO4 |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 395.02 |
| IUPAC Name | 2-(2,3,4,5,6-pentafluorophenyl)peroxybenzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3cccc(c23)C(=O)N1OOc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H6F5NO4/c19-11-12(20)14(22)16(15(23)13(11)21)27-28-24-17(25)8-5-1-3-7-4-2-6-9(10(7)8)18(24)26/h1-6H |
| InChIKey | PGHLCXZDJYOJGM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|