C18H8F5NO5S — CID 20693856
(1-hydroxy-3-oxo-1H-benzo[de]isoquinolin-2-yl) (2,3,4,5,6-pentafluorophenyl) sulfite (PubChem CID 20693856) has the molecular formula C18H8F5NO5S and a molecular weight of 445.32 g/mol. Its IUPAC name is (1-hydroxy-3-oxo-1H-benzo[de]isoquinolin-2-yl) (2,3,4,5,6-pentafluorophenyl) sulfite.
| Compound Name | (1-hydroxy-3-oxo-1H-benzo[de]isoquinolin-2-yl) (2,3,4,5,6-pentafluorophenyl) sulfite |
|---|---|
| PubChem CID | 20693856 |
| Molecular Formula | C18H8F5NO5S |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 445.00 |
| IUPAC Name | (1-hydroxy-3-oxo-1H-benzo[de]isoquinolin-2-yl) (2,3,4,5,6-pentafluorophenyl) sulfite |
| SMILES | O=C1c2cccc3cccc(c23)C(O)N1OS(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H8F5NO5S/c19-11-12(20)14(22)16(15(23)13(11)21)28-30(27)29-24-17(25)8-5-1-3-7-4-2-6-9(10(7)8)18(24)26/h1-6,17,25H |
| InChIKey | CSLQYYGRVWZNJL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|